CAS 781-32-8 appears in our catalog under these names: (2-Bromoprop-1-ene-1,1-diyl)dibenzene, 95%, 95%, Benzene, 1,1'-(2-bromo-1-propenylidene)bis-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-1-phenylprop-1-enyl)benzene (CAS 781-32-8) is a chemical compound with the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. IUPAC name: (2-bromo-1-phenylprop-1-enyl)benzene. InChIKey: JUEBDJZEVFVZKZ-UHFFFAOYSA-N.
| Molecular formula | C15H13Br |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | (2-bromo-1-phenylprop-1-enyl)benzene |
| InChIKey | JUEBDJZEVFVZKZ-UHFFFAOYSA-N |
| SMILES | CC(=C(C1=CC=CC=C1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)