CAS 1225053-54-2 appears in our catalog under these names: 1-Bromo-9,9-dimethyl-9H-fluorene, 98%, 98%, 9H-Fluorene, 1-bromo-9,9-dimethyl-, 98%, 1-Bromo-9,9-dimethyl-9H-fluorene, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-9,9-dimethylfluorene (CAS 1225053-54-2) is a chemical compound with the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. IUPAC name: 1-bromo-9,9-dimethylfluorene. InChIKey: KMZUUSFWPQLMQE-UHFFFAOYSA-N.
| Molecular formula | C15H13Br |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 1-bromo-9,9-dimethylfluorene |
| InChIKey | KMZUUSFWPQLMQE-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C(=CC=C3)Br)C |
Computed by PubChem (NCBI)