CAS 62856-31-9 is the registry number for 4-Bromo-4'-methylstilbene. Offered by: TRC. Available pack sizes: 750mg.
1-bromo-4-[2-(4-methylphenyl)ethenyl]benzene (CAS 62856-31-9) is a chemical compound with the molecular formula C15H13Br and a molecular weight of 273.17 g/mol. IUPAC name: 1-bromo-4-[2-(4-methylphenyl)ethenyl]benzene. InChIKey: CTMYIJULQXZVJH-UHFFFAOYSA-N.
| Molecular formula | C15H13Br |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 1-bromo-4-[2-(4-methylphenyl)ethenyl]benzene |
| InChIKey | CTMYIJULQXZVJH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C=CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)