CAS 1190380-50-7 appears in our catalog under these names: 4-Nitro-1-(tetrahydro-2H-pyran-4-yl-1H-pyrazole, 4-Nitro-1-(oxan-4-yl)-1H-pyrazole. Offered by: TRC, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-nitro-1-(oxan-4-yl)pyrazole (CAS 1190380-50-7) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: 4-nitro-1-(oxan-4-yl)pyrazole. InChIKey: WNGOPKGWJNIWCU-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 4-nitro-1-(oxan-4-yl)pyrazole |
| InChIKey | WNGOPKGWJNIWCU-UHFFFAOYSA-N |
| SMILES | C1COCCC1N2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)