Products 1190861-69-8
CAS 1190861-69-8 appears in our catalog under these names: 6-Bromo-1,3,3-trimethylindolin-2-one, 95%, 6-bromo-1,3,3-trimethylindolin-2-one, 98%, 98%, 6-BROMO-1,3,3-TRIMETHYLINDOLIN-2-ONE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
6-bromo-1,3,3-trimethylindol-2-one (CAS 1190861-69-8) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 6-bromo-1,3,3-trimethylindol-2-one. InChIKey: SALXSOUNYQHQGF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 6-bromo-1,3,3-trimethylindol-2-one |
| InChIKey | SALXSOUNYQHQGF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)N(C1=O)C)C |
Computed by PubChem (NCBI)