Products 119102-52-2

CAS 119102-52-2 is the registry number for Umeclidinium bromide Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 1-azabicyclo[3.2.1]octane-5-carboxylate (CAS 119102-52-2) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: ethyl 1-azabicyclo[3.2.1]octane-5-carboxylate. InChIKey: GGMVZFHWAZRGSF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO2
Molecular weight183.25 g/mol
IUPAC nameethyl 1-azabicyclo[3.2.1]octane-5-carboxylate
InChIKeyGGMVZFHWAZRGSF-UHFFFAOYSA-N
SMILESCCOC(=O)C12CCCN(C1)CC2

Computed by PubChem (NCBI)