Products 1191063-75-8
CAS 1191063-75-8 is the registry number for 6-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydronaphthalen-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-naphthalen-2-one (CAS 1191063-75-8) is a chemical compound with the molecular formula C16H21BO3 and a molecular weight of 272.1 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-naphthalen-2-one. InChIKey: ZITCBMVSFHOFEC-UHFFFAOYSA-N.
| Molecular formula | C16H21BO3 |
|---|---|
| Molecular weight | 272.1 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | ZITCBMVSFHOFEC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CC(=O)CC3)C=C2 |
Computed by PubChem (NCBI)