CAS 915402-05-0 appears in our catalog under these names: 4-(Cyclopropylcarbonyl)phenylboronic acid pinacol ester, 98%, Cyclopropyl(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 915402-05-0) is a chemical compound with the molecular formula C16H21BO3 and a molecular weight of 272.1 g/mol. IUPAC name: cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: TXKSCAGVSMSVQZ-UHFFFAOYSA-N.
| Molecular formula | C16H21BO3 |
|---|---|
| Molecular weight | 272.1 g/mol |
| IUPAC name | cyclopropyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | TXKSCAGVSMSVQZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)C3CC3 |
Computed by PubChem (NCBI)