Products 2244702-79-0
CAS 2244702-79-0 is the registry number for Cyclopropyl(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanone, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (CAS 2244702-79-0) is a chemical compound with the molecular formula C16H21BO3 and a molecular weight of 272.1 g/mol. IUPAC name: cyclopropyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone. InChIKey: QCSAWTLTQZGLAE-UHFFFAOYSA-N.
| Molecular formula | C16H21BO3 |
|---|---|
| Molecular weight | 272.1 g/mol |
| IUPAC name | cyclopropyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| InChIKey | QCSAWTLTQZGLAE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)C3CC3 |
Computed by PubChem (NCBI)