Products 2559765-25-0
CAS 2559765-25-0 is the registry number for 1-(4-(1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl)phenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone (CAS 2559765-25-0) is a chemical compound with the molecular formula C16H21BO3 and a molecular weight of 272.1 g/mol. IUPAC name: 1-[4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone. InChIKey: HWEIVEVPBQZOEQ-UHFFFAOYSA-N.
| Molecular formula | C16H21BO3 |
|---|---|
| Molecular weight | 272.1 g/mol |
| IUPAC name | 1-[4-[1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]ethanone |
| InChIKey | HWEIVEVPBQZOEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)