CAS 1191265-66-3 is the registry number for 2-Quinolinemethanol, 1,2,3,4-tetrahydro-, hydrochloride (1, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol;hydrochloride (CAS 1191265-66-3) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: [(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol;hydrochloride. InChIKey: SEZYKJICURYYRT-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | [(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methanol;hydrochloride |
| InChIKey | SEZYKJICURYYRT-FVGYRXGTSA-N |
| SMILES | C1CC2=CC=CC=C2N[C@@H]1CO.Cl |
Computed by PubChem (NCBI)