CAS 1191545-46-6 appears in our catalog under these names: 2-Methyl-3-(trifluoromethyl)benzenesulfonyl chloride, 95%, 2-Methyl-3-(trifluoromethyl)benzenesulfonyl chloride, 2-Methyl-3-trifluoromethylbenzenesulfonylchloride, 95+%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 100mg.
2-methyl-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 1191545-46-6) is a chemical compound with the molecular formula C8H6ClF3O2S and a molecular weight of 258.65 g/mol. IUPAC name: 2-methyl-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: BQIPHYPNVYOSER-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2S |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 2-methyl-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | BQIPHYPNVYOSER-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)