CAS 85952-32-5 appears in our catalog under these names: 2-Trifluoromethylbenzylsulfonyl chloride, 97%, (2-(Trifluoromethyl)phenyl)methanesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 500mg, 2.5g.
[2-(trifluoromethyl)phenyl]methanesulfonyl chloride (CAS 85952-32-5) is a chemical compound with the molecular formula C8H6ClF3O2S and a molecular weight of 258.65 g/mol. IUPAC name: [2-(trifluoromethyl)phenyl]methanesulfonyl chloride. InChIKey: RFFCAUGRAMHQSO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2S |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | [2-(trifluoromethyl)phenyl]methanesulfonyl chloride |
| InChIKey | RFFCAUGRAMHQSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)