Products 85952-32-5

CAS 85952-32-5 appears in our catalog under these names: 2-Trifluoromethylbenzylsulfonyl chloride, 97%, (2-(Trifluoromethyl)phenyl)methanesulfonyl chloride, 96%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 500mg, 2.5g.

Structural formula: {0} (CAS {1})

[2-(trifluoromethyl)phenyl]methanesulfonyl chloride (CAS 85952-32-5) is a chemical compound with the molecular formula C8H6ClF3O2S and a molecular weight of 258.65 g/mol. IUPAC name: [2-(trifluoromethyl)phenyl]methanesulfonyl chloride. InChIKey: RFFCAUGRAMHQSO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClF3O2S
Molecular weight258.65 g/mol
IUPAC name[2-(trifluoromethyl)phenyl]methanesulfonyl chloride
InChIKeyRFFCAUGRAMHQSO-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CS(=O)(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)