CAS 151258-36-5 appears in our catalog under these names: 4-Methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 95%, 4-Methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride, 98+%, 4-Methyl-3-(trifluoromethyl)benzene-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 1g, 10g, 0,5g.
4-methyl-3-(trifluoromethyl)benzenesulfonyl chloride (CAS 151258-36-5) is a chemical compound with the molecular formula C8H6ClF3O2S and a molecular weight of 258.65 g/mol. IUPAC name: 4-methyl-3-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: QDMYYKYFUZKZKK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2S |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 4-methyl-3-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | QDMYYKYFUZKZKK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)