Products 89807-52-3
CAS 89807-52-3 is the registry number for 1-(Chloromethyl)-4-((trifluoromethyl)sulfonyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(chloromethyl)-4-(trifluoromethylsulfonyl)benzene (CAS 89807-52-3) is a chemical compound with the molecular formula C8H6ClF3O2S and a molecular weight of 258.65 g/mol. IUPAC name: 1-(chloromethyl)-4-(trifluoromethylsulfonyl)benzene. InChIKey: GVLRLPBIYKDVDO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O2S |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(trifluoromethylsulfonyl)benzene |
| InChIKey | GVLRLPBIYKDVDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)