Products 1191900-73-8
CAS 1191900-73-8 appears in our catalog under these names: Brexpiprazole Impurity 84, Brexpiprazole Impurity 79, 4-(Piperazin-1-yl)benzo[b]thiophene 1-oxide, 98%. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-piperazin-1-yl-1-benzothiophene 1-oxide (CAS 1191900-73-8) is a chemical compound with the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. IUPAC name: 4-piperazin-1-yl-1-benzothiophene 1-oxide. InChIKey: XGLXPENQCGXZNB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2OS |
|---|---|
| Molecular weight | 234.32 g/mol |
| IUPAC name | 4-piperazin-1-yl-1-benzothiophene 1-oxide |
| InChIKey | XGLXPENQCGXZNB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C3C=CS(=O)C3=CC=C2 |
Computed by PubChem (NCBI)