CAS 119198-88-8 appears in our catalog under these names: 2,4,6–Trimethylbenzene–1,3,5–tricarbaldehyde, 2,4,6-Trimethylbenzene-1,3,5-tricarbaldehyde, 97%, 97%, 2,4,6-Trimethylbenzene-1,3,5-tricarbaldehyde, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,4,6-trimethylbenzene-1,3,5-tricarbaldehyde (CAS 119198-88-8) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 2,4,6-trimethylbenzene-1,3,5-tricarbaldehyde. InChIKey: IBNLLMKGXOOWHH-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2,4,6-trimethylbenzene-1,3,5-tricarbaldehyde |
| InChIKey | IBNLLMKGXOOWHH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C=O)C)C=O)C)C=O |
Computed by PubChem (NCBI)