CAS 119205-38-8 appears in our catalog under these names: 3-Amino-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid methyl ester, 97%, 97%, 3-Amino-4,5,6,7-tetrahydro-benzo[b]thiophene-2-carboxylic acid methyl ester, 98%, Methyl 3-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 119205-38-8) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: methyl 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: WBBFZXDFNCRFGM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | methyl 3-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | WBBFZXDFNCRFGM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)CCCC2)N |
Computed by PubChem (NCBI)