Products 1192233-59-2
CAS 1192233-59-2 is the registry number for 3-[(Pyridin-2-yl)sulfonyl]benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3-pyridin-2-ylsulfonylbenzoic acid (CAS 1192233-59-2) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: 3-pyridin-2-ylsulfonylbenzoic acid. InChIKey: PUGLFGCDJRKFRN-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 3-pyridin-2-ylsulfonylbenzoic acid |
| InChIKey | PUGLFGCDJRKFRN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)