CAS 1266962-86-0 is the registry number for 2-((3-Carboxyphenyl)methyl)-4-thiazolecarboxylic Acid. Offered by: TRC. Available pack sizes: 1g.
2-[(3-carboxyphenyl)methyl]-1,3-thiazole-4-carboxylic acid (CAS 1266962-86-0) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: 2-[(3-carboxyphenyl)methyl]-1,3-thiazole-4-carboxylic acid. InChIKey: YWAIRRCLKMMADJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2-[(3-carboxyphenyl)methyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | YWAIRRCLKMMADJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)