Products 1312815-35-2
CAS 1312815-35-2 appears in our catalog under these names: Febuxostat Impurity 35, Febuxostat Impurity O, Febuxostat Impurity 59. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3-formyl-4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1312815-35-2) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: 2-(3-formyl-4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: ZNQXEYNLIWHYMY-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2-(3-formyl-4-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | ZNQXEYNLIWHYMY-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)O)C=O)C(=O)O |
Computed by PubChem (NCBI)