CAS 938363-46-3 appears in our catalog under these names: 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-carboxylic acid (CAS 938363-46-3) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: CDLVCRVTSGOFKM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | CDLVCRVTSGOFKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)