Products 773100-17-7
CAS 773100-17-7 is the registry number for 6-(Phenylsulfonyl)nicotinic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
6-(benzenesulfonyl)pyridine-3-carboxylic acid (CAS 773100-17-7) is a chemical compound with the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. IUPAC name: 6-(benzenesulfonyl)pyridine-3-carboxylic acid. InChIKey: BMJOMMLLJFHDBF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4S |
|---|---|
| Molecular weight | 263.27 g/mol |
| IUPAC name | 6-(benzenesulfonyl)pyridine-3-carboxylic acid |
| InChIKey | BMJOMMLLJFHDBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)