CAS 119238-52-7 appears in our catalog under these names: D-Captopril, D-Captopril, >95% (HPLC), D-Captopril 98%, 1-[(2S)-3-Mercapto-2-methyl-1-oxopropyl]-D-proline, 98%, 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 10mg, 2,5mg, 25mg, 50mg, 1mg, 5mg.
(2R)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 119238-52-7) is a chemical compound with the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. IUPAC name: (2R)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: FAKRSMQSSFJEIM-RNFRBKRXSA-N.
| Molecular formula | C9H15NO3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | (2R)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | FAKRSMQSSFJEIM-RNFRBKRXSA-N |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)