Products 1211114-17-8
CAS 1211114-17-8 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)(pyrrolidin-1-yl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,1-dioxothiolan-3-yl)-pyrrolidin-1-ylmethanone (CAS 1211114-17-8) is a chemical compound with the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. IUPAC name: (1,1-dioxothiolan-3-yl)-pyrrolidin-1-ylmethanone. InChIKey: PWKOYNKYSKRXTK-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | (1,1-dioxothiolan-3-yl)-pyrrolidin-1-ylmethanone |
| InChIKey | PWKOYNKYSKRXTK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)