Products 1218495-99-8

CAS 1218495-99-8 is the registry number for 1-(2-(Methylthio)acetyl)piperidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(2-methylsulfanylacetyl)piperidine-2-carboxylic acid (CAS 1218495-99-8) is a chemical compound with the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. IUPAC name: 1-(2-methylsulfanylacetyl)piperidine-2-carboxylic acid. InChIKey: QBUVHOWPXQTBOS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO3S
Molecular weight217.29 g/mol
IUPAC name1-(2-methylsulfanylacetyl)piperidine-2-carboxylic acid
InChIKeyQBUVHOWPXQTBOS-UHFFFAOYSA-N
SMILESCSCC(=O)N1CCCCC1C(=O)O

Computed by PubChem (NCBI)