CAS 1356383-38-4 appears in our catalog under these names: Captopril-d3, Captopril-d3, >95% (HPLC), Captopril–d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 100μg.
(2S)-2,5,5-trideuterio-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 1356383-38-4) is a chemical compound with the molecular formula C9H15NO3S and a molecular weight of 220.31 g/mol. IUPAC name: (2S)-2,5,5-trideuterio-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: FAKRSMQSSFJEIM-SIHDFBQLSA-N.
| Molecular formula | C9H15NO3S |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | (2S)-2,5,5-trideuterio-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | FAKRSMQSSFJEIM-SIHDFBQLSA-N |
| SMILES | [2H][C@]1(CCC(N1C(=O)[C@H](C)CS)([2H])[2H])C(=O)O |
Computed by PubChem (NCBI)