CAS 1192772-71-6 appears in our catalog under these names: 2-Methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid, 95%, 2-Methyl-3-(4-(trifluoromethyl)phenyl)propanoic acid, 2-(4-(Trifluoromethyl)benzyl)propanoic acid, 98%, 98%, 2-(4-(TRIFLUOROMETHYL)BENZYL)PROPANOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 0,5g, 2g, 10g, 100mg, 50mg.
2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid (CAS 1192772-71-6) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid. InChIKey: KOPLOHWBAJQCOI-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 2-methyl-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | KOPLOHWBAJQCOI-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)