CAS 1289092-04-1 is the registry number for 4-Isopropoxy-3-(trifluoromethyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-propan-2-yloxy-3-(trifluoromethyl)benzaldehyde (CAS 1289092-04-1) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 4-propan-2-yloxy-3-(trifluoromethyl)benzaldehyde. InChIKey: ZHGZBZHLMHHFHV-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 4-propan-2-yloxy-3-(trifluoromethyl)benzaldehyde |
| InChIKey | ZHGZBZHLMHHFHV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C=O)C(F)(F)F |
Computed by PubChem (NCBI)