CAS 136295-01-7 appears in our catalog under these names: 4-[4-(Trifluoromethyl)phenyl]butanoic acid, 95%, 4-(Trifluoromethyl)-benzenebutanoic acid, 4-(4-(Trifluoromethyl)phenyl)butanoic acid, 98%, 98%, 4-(4-(Trifluoromethyl)phenyl)butanoic acid, 98%, 4-(4-(Trifluoromethyl)phenyl)butanoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g, 100g, 250g.
4-[4-(trifluoromethyl)phenyl]butanoic acid (CAS 136295-01-7) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenyl]butanoic acid. InChIKey: YZESNPBHOXIPRA-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | YZESNPBHOXIPRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)