CAS 1261553-60-9 appears in our catalog under these names: Methyl 4-methyl-3-trifluoromethylphenylacetate, 95%, Methyl 2–(4–methyl–3–(trifluoromethyl)phenyl)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 10g, 5g, 250mg.
Methyl 2-[4-methyl-3-(trifluoromethyl)phenyl]acetate (CAS 1261553-60-9) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: methyl 2-[4-methyl-3-(trifluoromethyl)phenyl]acetate. InChIKey: QNYCASKFLHIXOY-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | methyl 2-[4-methyl-3-(trifluoromethyl)phenyl]acetate |
| InChIKey | QNYCASKFLHIXOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)