CAS 119282-92-7 is the registry number for 4-Methoxy-6-methylbenzo[d]thiazol-2-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-6-methyl-1,3-benzothiazol-2-amine (CAS 119282-92-7) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-methoxy-6-methyl-1,3-benzothiazol-2-amine. InChIKey: XJYZYIJQEOASSP-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-methoxy-6-methyl-1,3-benzothiazol-2-amine |
| InChIKey | XJYZYIJQEOASSP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)SC(=N2)N)OC |
Computed by PubChem (NCBI)