CAS 119306-51-3 is the registry number for R8605. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoic acid (CAS 119306-51-3) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoic acid. InChIKey: SOUMNAXAAYKDPQ-UHFFFAOYSA-N.
| Molecular formula | C22H27NO4 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoic acid |
| InChIKey | SOUMNAXAAYKDPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)