Products 51444-79-2

CAS 51444-79-2 appears in our catalog under these names: 4-((2-(Octyloxy)benzoyl)amino)benzoic Acid, Otilonium Bromide Impurity 4. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 1g, 250mg, 500mg, on request.

4-[(2-octoxybenzoyl)amino]benzoic acid (CAS 51444-79-2) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: 4-[(2-octoxybenzoyl)amino]benzoic acid. InChIKey: IYKWPMYHASDTRV-UHFFFAOYSA-N.

Identity
Molecular formulaC22H27NO4
Molecular weight369.5 g/mol
IUPAC name4-[(2-octoxybenzoyl)amino]benzoic acid
InChIKeyIYKWPMYHASDTRV-UHFFFAOYSA-N
SMILESCCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)