CAS 162536-84-7 appears in our catalog under these names: Erythro-n-boc-o-benzyl-l-tyrosine epoxide, 95%, Erythro-N-Boc-O-benzyl-L-tyrosine epoxide, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
Tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]carbamate (CAS 162536-84-7) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]carbamate. InChIKey: WKKSCOKVTJQVPD-VQTJNVASSA-N.
| Molecular formula | C22H27NO4 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-2-(4-phenylmethoxyphenyl)ethyl]carbamate |
| InChIKey | WKKSCOKVTJQVPD-VQTJNVASSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC2=CC=CC=C2)[C@H]3CO3 |
Computed by PubChem (NCBI)