Products 75500-95-7

CAS 75500-95-7 is the registry number for Drotaverine hydrochloride Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(6,7-diethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-ethoxyphenol (CAS 75500-95-7) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: 4-[(6,7-diethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-ethoxyphenol. InChIKey: HGOGJTGPUKGNER-UHFFFAOYSA-N.

Identity
Molecular formulaC22H27NO4
Molecular weight369.5 g/mol
IUPAC name4-[(6,7-diethoxy-3,4-dihydroisoquinolin-1-yl)methyl]-2-ethoxyphenol
InChIKeyHGOGJTGPUKGNER-UHFFFAOYSA-N
SMILESCCOC1=C(C=C2C(=C1)CCN=C2CC3=CC(=C(C=C3)O)OCC)OCC

Computed by PubChem (NCBI)