Products 1193176-37-2
CAS 1193176-37-2 is the registry number for (+)-Pinanediol-2-O-(hydrogen Sulfate). Offered by: TRC. Available pack sizes: 250mg.
[(1R,2R,3S,5R)-3-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl] hydrogen sulfate (CAS 1193176-37-2) is a chemical compound with the molecular formula C10H18O5S and a molecular weight of 250.31 g/mol. IUPAC name: [(1R,2R,3S,5R)-3-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl] hydrogen sulfate. InChIKey: ILHOCWLIIOSISF-BDNRQGISSA-N.
| Molecular formula | C10H18O5S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | [(1R,2R,3S,5R)-3-hydroxy-2,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl] hydrogen sulfate |
| InChIKey | ILHOCWLIIOSISF-BDNRQGISSA-N |
| SMILES | C[C@]1([C@@H]2C[C@@H](C2(C)C)C[C@@H]1O)OS(=O)(=O)O |
Computed by PubChem (NCBI)