CAS 2260788-71-2 is the registry number for rel-tert-Butyl (1s,3s)-3-((methylsulfonyl)oxy)cyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-methylsulfonyloxycyclobutane-1-carboxylate (CAS 2260788-71-2) is a chemical compound with the molecular formula C10H18O5S and a molecular weight of 250.31 g/mol. IUPAC name: tert-butyl 3-methylsulfonyloxycyclobutane-1-carboxylate. InChIKey: LCDHAPKXGKHTRD-UHFFFAOYSA-N.
| Molecular formula | C10H18O5S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | tert-butyl 3-methylsulfonyloxycyclobutane-1-carboxylate |
| InChIKey | LCDHAPKXGKHTRD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)