CAS 98673-87-1 appears in our catalog under these names: (1S)-(+)-Camphor-10-sulfonic acid monohydrate, 97%, 97%, ((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid hydrate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 500g.
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate (CAS 98673-87-1) is a chemical compound with the molecular formula C10H18O5S and a molecular weight of 250.31 g/mol. IUPAC name: [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate. InChIKey: GAQWDBUWBUOFLS-YZUKSGEXSA-N.
| Molecular formula | C10H18O5S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate |
| InChIKey | GAQWDBUWBUOFLS-YZUKSGEXSA-N |
| SMILES | CC1([C@@H]2CC[C@]1(C(=O)C2)CS(=O)(=O)O)C.O |
Computed by PubChem (NCBI)