Products 1890438-96-6
CAS 1890438-96-6 is the registry number for tert-Butyl 2-(3-Hydroxy-1,1-dioxidotetrahydrothiophen-3-yl)acetate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate (CAS 1890438-96-6) is a chemical compound with the molecular formula C10H18O5S and a molecular weight of 250.31 g/mol. IUPAC name: tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate. InChIKey: TUNZOGOESYBNMD-UHFFFAOYSA-N.
| Molecular formula | C10H18O5S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate |
| InChIKey | TUNZOGOESYBNMD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1(CCS(=O)(=O)C1)O |
Computed by PubChem (NCBI)