Products 1193251-95-4
CAS 1193251-95-4 is the registry number for 7-Alkynyl-Fucose Tetraacetate. Offered by: Biosynth. Available pack sizes: 0,5mg.
[(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate (CAS 1193251-95-4) is a chemical compound with the molecular formula C16H20O9 and a molecular weight of 356.32 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate. InChIKey: PQRBJNAJCNCVPG-JSKHOMAGSA-N.
| Molecular formula | C16H20O9 |
|---|---|
| Molecular weight | 356.32 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate |
| InChIKey | PQRBJNAJCNCVPG-JSKHOMAGSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C)CC#C |
Computed by PubChem (NCBI)