CAS 137887-25-3 appears in our catalog under these names: 6-O-Feruloyl-beta-D-Glucose , 6-O-Feruloylglucose. Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 5mg, 5 mg, 1 mg.
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 137887-25-3) is a chemical compound with the molecular formula C16H20O9 and a molecular weight of 356.32 g/mol. IUPAC name: [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: SQBITMSCIPALTP-LFJMMHPDSA-N.
| Molecular formula | C16H20O9 |
|---|---|
| Molecular weight | 356.32 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | SQBITMSCIPALTP-LFJMMHPDSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)