CAS 168105-32-6 is the registry number for (2R,3R,4R,5S,6S)-2-(Acetoxymethyl)-6-ethynyltetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxan-2-yl]methyl acetate (CAS 168105-32-6) is a chemical compound with the molecular formula C16H20O9 and a molecular weight of 356.32 g/mol. IUPAC name: [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxan-2-yl]methyl acetate. InChIKey: HAVBGJDVNNVPRE-ZVDSWSACSA-N.
| Molecular formula | C16H20O9 |
|---|---|
| Molecular weight | 356.32 g/mol |
| IUPAC name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-ethynyloxan-2-yl]methyl acetate |
| InChIKey | HAVBGJDVNNVPRE-ZVDSWSACSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)C#C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)