CAS 7196-71-6 appears in our catalog under these names: Ferulic acid acyl-beta-d-glucoside, 95%, Ferulic Acid Acyl-beta-D-glucoside, Ferulic acid acyl–β–D–glucoside, Ferulic acid acyl-b-D-glucoside, b-D-Glucopyranose, 1-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate], 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 50mg, 1mg, 5mg, 10mM (in 1ml water), 250mg, 500mg, 25mg.
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 7196-71-6) is a chemical compound with the molecular formula C16H20O9 and a molecular weight of 356.32 g/mol. IUPAC name: [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: JWRQVQWBNRGGPK-JZYAIQKZSA-N.
| Molecular formula | C16H20O9 |
|---|---|
| Molecular weight | 356.32 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | JWRQVQWBNRGGPK-JZYAIQKZSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
Computed by PubChem (NCBI)