CAS 1193387-95-9 appears in our catalog under these names: (4–Bromophenyl)(cyclobutyl)methanamine hydrochloride, (4-Bromophenyl)(cyclobutyl)methanamine hydrochloride, (4-Bromophenyl)(cyclobutyl)methanamine hydrochloride, 97%, 97%, (4-Bromophenyl)(cyclobutyl)methanamine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 50mg, 500mg.
(4-bromophenyl)-cyclobutylmethanamine;hydrochloride (CAS 1193387-95-9) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: (4-bromophenyl)-cyclobutylmethanamine;hydrochloride. InChIKey: YMMWYFYGXSVGJK-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | (4-bromophenyl)-cyclobutylmethanamine;hydrochloride |
| InChIKey | YMMWYFYGXSVGJK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=CC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)