CAS 119349-57-4 is the registry number for 2-Amino-3-(3-phenoxyphenyl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-3-(3-phenoxyphenyl)propanoic acid (CAS 119349-57-4) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-amino-3-(3-phenoxyphenyl)propanoic acid. InChIKey: CVEJYSBWVPCQMR-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-amino-3-(3-phenoxyphenyl)propanoic acid |
| InChIKey | CVEJYSBWVPCQMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CC(C(=O)O)N |
Computed by PubChem (NCBI)