CAS 119362-54-8 is the registry number for 6-Ethynyl-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethynyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 119362-54-8) is a chemical compound with the molecular formula C16H20 and a molecular weight of 212.33 g/mol. IUPAC name: 6-ethynyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: HROQNFYTUDZWBY-UHFFFAOYSA-N.
| Molecular formula | C16H20 |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 6-ethynyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | HROQNFYTUDZWBY-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)C#C)(C)C)C |
Computed by PubChem (NCBI)