CAS 40458-98-8 appears in our catalog under these names: 2,7-Diisopropylnaphthalene, 98%, 2,7-Diisopropylnaphthalene, 95%, 2,7-Diisopropylnaphthalene, >95% (HPLC), 2,7–Diisopropylnaphthalene, 2,7-Diisopropylnaphthalene, >95.0%(GC). Offered by: AmBeed, Combi-blocks, TRC, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, 2,5g, 250mg, 500mg, 5ml, 25ml.
2,7-di(propan-2-yl)naphthalene (CAS 40458-98-8) is a chemical compound with the molecular formula C16H20 and a molecular weight of 212.33 g/mol. IUPAC name: 2,7-di(propan-2-yl)naphthalene. InChIKey: YGDMAJYAQCDTNG-UHFFFAOYSA-N.
| Molecular formula | C16H20 |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 2,7-di(propan-2-yl)naphthalene |
| InChIKey | YGDMAJYAQCDTNG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)C=CC(=C2)C(C)C |
Computed by PubChem (NCBI)