CAS 24157-79-7 appears in our catalog under these names: 1,4–Diisopropylnaphthalene, 1,4-Diisopropylnaphthalene. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 50mg.
1,4-di(propan-2-yl)naphthalene (CAS 24157-79-7) is a chemical compound with the molecular formula C16H20 and a molecular weight of 212.33 g/mol. IUPAC name: 1,4-di(propan-2-yl)naphthalene. InChIKey: BDJUQNIAPKYGNU-UHFFFAOYSA-N.
| Molecular formula | C16H20 |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 1,4-di(propan-2-yl)naphthalene |
| InChIKey | BDJUQNIAPKYGNU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C2=CC=CC=C21)C(C)C |
Computed by PubChem (NCBI)