CAS 57122-16-4 appears in our catalog under these names: 1,3–Diisopropylnaphthalene, 1,3-diisopropylnaphthalene, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1,3-di(propan-2-yl)naphthalene (CAS 57122-16-4) is a chemical compound with the molecular formula C16H20 and a molecular weight of 212.33 g/mol. IUPAC name: 1,3-di(propan-2-yl)naphthalene. InChIKey: JDBFIFNXALGSOF-UHFFFAOYSA-N.
| Molecular formula | C16H20 |
|---|---|
| Molecular weight | 212.33 g/mol |
| IUPAC name | 1,3-di(propan-2-yl)naphthalene |
| InChIKey | JDBFIFNXALGSOF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=CC=CC=C2C(=C1)C(C)C |
Computed by PubChem (NCBI)